About 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol
2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol (PubChem CID 126830559) has the molecular formula C17H24F3NO3
and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol |
| PubChem CID | 126830559 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol |
| SMILES | OCCN(CCO)C[C@@H]1CCCO[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H24F3NO3/c18-17(19,20)15-5-3-13(4-6-15)16-14(2-1-11-24-16)12-21(7-9-22)8-10-23/h3-6,14,16,22-23H,1-2,7-12H2/t14-,16-/m0/s1 |
| InChIKey | YFOMDAOENVUCPA-HOCLYGCPSA-N |
| XLogP | 2.46 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol?
The IUPAC name of 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol (CID 126830559) is 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol.
What is the SMILES notation for 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol?
The canonical SMILES for 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol is OCCN(CCO)C[C@@H]1CCCO[C@H]1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol?
The InChIKey is YFOMDAOENVUCPA-HOCLYGCPSA-N. The full InChI is InChI=1S/C17H24F3NO3/c18-17(19,20)15-5-3-13(4-6-15)16-14(2-1-11-24-16)12-21(7-9-22)8-10-23/h3-6,14,16,22-23H,1-2,7-12H2/t14-,16-/m0/s1.
What are the key properties of 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol?
2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol has a molecular weight of 347.38 g/mol, XLogP of 2.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-hydroxyethyl-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]amino]ethanol is sourced from PubChem (CID 126830559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).