About [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol
[1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol (PubChem CID 126830560) has the molecular formula C18H24F3NO2
and a molecular weight of 343.39 g/mol. Its IUPAC name is [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol |
| PubChem CID | 126830560 |
| Molecular Formula | C18H24F3NO2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1C[C@@H]1CCCO[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F3NO2/c19-18(20,21)15-7-5-13(6-8-15)17-14(3-2-10-24-17)11-22-9-1-4-16(22)12-23/h5-8,14,16-17,23H,1-4,9-12H2/t14-,16?,17-/m0/s1 |
| InChIKey | HWAFOOYFMKWCCV-NZEUDUFCSA-N |
| XLogP | 3.63 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol?
The IUPAC name of [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol (CID 126830560) is [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol.
What is the SMILES notation for [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol?
The canonical SMILES for [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol is OCC1CCCN1C[C@@H]1CCCO[C@H]1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol?
The InChIKey is HWAFOOYFMKWCCV-NZEUDUFCSA-N. The full InChI is InChI=1S/C18H24F3NO2/c19-18(20,21)15-7-5-13(6-8-15)17-14(3-2-10-24-17)11-22-9-1-4-16(22)12-23/h5-8,14,16-17,23H,1-4,9-12H2/t14-,16?,17-/m0/s1.
What are the key properties of [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol?
[1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol has a molecular weight of 343.39 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[(2R,3S)-2-[4-(trifluoromethyl)phenyl]oxan-3-yl]methyl]pyrrolidin-2-yl]methanol is sourced from PubChem (CID 126830560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).