C13H15F2N5O — CID 126830682
N'-[[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methoxy]-2-phenylethanimidamide (PubChem CID 126830682) has the molecular formula C13H15F2N5O and a molecular weight of 295.29 g/mol. Its IUPAC name is N'-[[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methoxy]-2-phenylethanimidamide.
| Compound Name | N'-[[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methoxy]-2-phenylethanimidamide |
|---|---|
| PubChem CID | 126830682 |
| Molecular Formula | C13H15F2N5O |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N'-[[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methoxy]-2-phenylethanimidamide |
| SMILES | NC(Cc1ccccc1)=NOCc1ncnn1CC(F)F |
| InChI | InChI=1S/C13H15F2N5O/c14-11(15)7-20-13(17-9-18-20)8-21-19-12(16)6-10-4-2-1-3-5-10/h1-5,9,11H,6-8H2,(H2,16,19) |
| InChIKey | MATJWAQYIGRIHS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|