C13H16N2O4S — CID 126830755
N-(4-ethoxy-2-methylphenyl)-3-methyl-1,2-oxazole-4-sulfonamide (PubChem CID 126830755) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is N-(4-ethoxy-2-methylphenyl)-3-methyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(4-ethoxy-2-methylphenyl)-3-methyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 126830755 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-(4-ethoxy-2-methylphenyl)-3-methyl-1,2-oxazole-4-sulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2conc2C)c(C)c1 |
| InChI | InChI=1S/C13H16N2O4S/c1-4-18-11-5-6-12(9(2)7-11)15-20(16,17)13-8-19-14-10(13)3/h5-8,15H,4H2,1-3H3 |
| InChIKey | OUIYUVGJCXUGOA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |