C13H19NO4S — CID 126831492
[4-(2-ethylphenyl)sulfonylmorpholin-3-yl]methanol (PubChem CID 126831492) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is [4-(2-ethylphenyl)sulfonylmorpholin-3-yl]methanol.
| Compound Name | [4-(2-ethylphenyl)sulfonylmorpholin-3-yl]methanol |
|---|---|
| PubChem CID | 126831492 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [4-(2-ethylphenyl)sulfonylmorpholin-3-yl]methanol |
| SMILES | CCc1ccccc1S(=O)(=O)N1CCOCC1CO |
| InChI | InChI=1S/C13H19NO4S/c1-2-11-5-3-4-6-13(11)19(16,17)14-7-8-18-10-12(14)9-15/h3-6,12,15H,2,7-10H2,1H3 |
| InChIKey | WCCZNWSNJUWSDW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |