C10H13N3O3 — CID 126831695
5-(1-prop-2-enoylpiperidin-3-yl)-3H-1,3,4-oxadiazol-2-one (PubChem CID 126831695) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 5-(1-prop-2-enoylpiperidin-3-yl)-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(1-prop-2-enoylpiperidin-3-yl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 126831695 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5-(1-prop-2-enoylpiperidin-3-yl)-3H-1,3,4-oxadiazol-2-one |
| SMILES | C=CC(=O)N1CCCC(c2n[nH]c(=O)o2)C1 |
| InChI | InChI=1S/C10H13N3O3/c1-2-8(14)13-5-3-4-7(6-13)9-11-12-10(15)16-9/h2,7H,1,3-6H2,(H,12,15) |
| InChIKey | UYCIIRKPYOYUMC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|