About 2,6-dibromobenzonitrile
2,6-dibromobenzonitrile (PubChem CID 12683209) has the molecular formula C7H3Br2N
and a molecular weight of 260.92 g/mol. Its IUPAC name is 2,6-dibromobenzonitrile.
Molecular Properties
| Compound Name | 2,6-dibromobenzonitrile |
| PubChem CID | 12683209 |
| Molecular Formula | C7H3Br2N |
| Molecular Weight | 260.92 g/mol |
| Exact Mass | 258.86 |
| IUPAC Name | 2,6-dibromobenzonitrile |
| SMILES | N#Cc1c(Br)cccc1Br |
| InChI | InChI=1S/C7H3Br2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| InChIKey | KBLLYABRMLFXFZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.92 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dibromobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromobenzonitrile?
The IUPAC name of 2,6-dibromobenzonitrile (CID 12683209) is 2,6-dibromobenzonitrile.
What is the SMILES notation for 2,6-dibromobenzonitrile?
The canonical SMILES for 2,6-dibromobenzonitrile is N#Cc1c(Br)cccc1Br.
What is the InChIKey of 2,6-dibromobenzonitrile?
The InChIKey is KBLLYABRMLFXFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Br2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H.
What are the key properties of 2,6-dibromobenzonitrile?
2,6-dibromobenzonitrile has a molecular weight of 260.92 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromobenzonitrile is sourced from PubChem (CID 12683209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).