About 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide
3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide (PubChem CID 126832327) has the molecular formula C14H13ClFN3O2S
and a molecular weight of 341.80 g/mol. Its IUPAC name is 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide |
| PubChem CID | 126832327 |
| Molecular Formula | C14H13ClFN3O2S |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1ncc2c(n1)CCC2)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C14H13ClFN3O2S/c15-10-4-11(16)6-12(5-10)22(20,21)18-8-14-17-7-9-2-1-3-13(9)19-14/h4-7,18H,1-3,8H2 |
| InChIKey | GIBOOATXNJKOCK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide?
The IUPAC name of 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide (CID 126832327) is 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide.
What is the SMILES notation for 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide?
The canonical SMILES for 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide is O=S(=O)(NCc1ncc2c(n1)CCC2)c1cc(F)cc(Cl)c1.
What is the InChIKey of 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide?
The InChIKey is GIBOOATXNJKOCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClFN3O2S/c15-10-4-11(16)6-12(5-10)22(20,21)18-8-14-17-7-9-2-1-3-13(9)19-14/h4-7,18H,1-3,8H2.
What are the key properties of 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide?
3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide has a molecular weight of 341.80 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-5-fluorobenzenesulfonamide is sourced from PubChem (CID 126832327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).