About N-benzyl-1,1-dimethoxymethanimine
N-benzyl-1,1-dimethoxymethanimine (PubChem CID 12683291) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is N-benzyl-1,1-dimethoxymethanimine.
Molecular Properties
| Compound Name | N-benzyl-1,1-dimethoxymethanimine |
| PubChem CID | 12683291 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-benzyl-1,1-dimethoxymethanimine |
| SMILES | COC(=NCc1ccccc1)OC |
| InChI | InChI=1S/C10H13NO2/c1-12-10(13-2)11-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | LVGOKVLQNBLKND-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1,1-dimethoxymethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1,1-dimethoxymethanimine?
The IUPAC name of N-benzyl-1,1-dimethoxymethanimine (CID 12683291) is N-benzyl-1,1-dimethoxymethanimine.
What is the SMILES notation for N-benzyl-1,1-dimethoxymethanimine?
The canonical SMILES for N-benzyl-1,1-dimethoxymethanimine is COC(=NCc1ccccc1)OC.
What is the InChIKey of N-benzyl-1,1-dimethoxymethanimine?
The InChIKey is LVGOKVLQNBLKND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-12-10(13-2)11-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3.
What are the key properties of N-benzyl-1,1-dimethoxymethanimine?
N-benzyl-1,1-dimethoxymethanimine has a molecular weight of 179.22 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1,1-dimethoxymethanimine is sourced from PubChem (CID 12683291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).