About 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine
3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine (PubChem CID 126833455) has the molecular formula C9H10F3NO3S3
and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine |
| PubChem CID | 126833455 |
| Molecular Formula | C9H10F3NO3S3 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine |
| SMILES | COc1ccsc1S(=O)(=O)N1CCSC1C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO3S3/c1-16-6-2-4-17-7(6)19(14,15)13-3-5-18-8(13)9(10,11)12/h2,4,8H,3,5H2,1H3 |
| InChIKey | HIIYYMHYRXDIPE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine?
The IUPAC name of 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine (CID 126833455) is 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine.
What is the SMILES notation for 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine?
The canonical SMILES for 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine is COc1ccsc1S(=O)(=O)N1CCSC1C(F)(F)F.
What is the InChIKey of 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine?
The InChIKey is HIIYYMHYRXDIPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NO3S3/c1-16-6-2-4-17-7(6)19(14,15)13-3-5-18-8(13)9(10,11)12/h2,4,8H,3,5H2,1H3.
What are the key properties of 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine?
3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine has a molecular weight of 333.38 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxythiophen-2-yl)sulfonyl-2-(trifluoromethyl)-1,3-thiazolidine is sourced from PubChem (CID 126833455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).