About N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide
N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide (PubChem CID 126833967) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide |
| PubChem CID | 126833967 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide |
| SMILES | Cc1c(NC(=O)Cc2ccoc2)c(=O)n(C2CCCCC2)n1C |
| InChI | InChI=1S/C17H23N3O3/c1-12-16(18-15(21)10-13-8-9-23-11-13)17(22)20(19(12)2)14-6-4-3-5-7-14/h8-9,11,14H,3-7,10H2,1-2H3,(H,18,21) |
| InChIKey | LCXFUZIBXSLIOM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide?
The IUPAC name of N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide (CID 126833967) is N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide.
What is the SMILES notation for N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide?
The canonical SMILES for N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide is Cc1c(NC(=O)Cc2ccoc2)c(=O)n(C2CCCCC2)n1C.
What is the InChIKey of N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide?
The InChIKey is LCXFUZIBXSLIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O3/c1-12-16(18-15(21)10-13-8-9-23-11-13)17(22)20(19(12)2)14-6-4-3-5-7-14/h8-9,11,14H,3-7,10H2,1-2H3,(H,18,21).
What are the key properties of N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide?
N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide has a molecular weight of 317.39 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclohexyl-2,3-dimethyl-5-oxopyrazol-4-yl)-2-(furan-3-yl)acetamide is sourced from PubChem (CID 126833967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).