About 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate
2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate (PubChem CID 126834028) has the molecular formula C14H16N2O3S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate.
Molecular Properties
| Compound Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate |
| PubChem CID | 126834028 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate |
| SMILES | Cc1nnc(CCOC(=O)CCSc2ccccc2)o1 |
| InChI | InChI=1S/C14H16N2O3S/c1-11-15-16-13(19-11)7-9-18-14(17)8-10-20-12-5-3-2-4-6-12/h2-6H,7-10H2,1H3 |
| InChIKey | XKJBOLORTFVMDC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate?
The IUPAC name of 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate (CID 126834028) is 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate.
What is the SMILES notation for 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate?
The canonical SMILES for 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate is Cc1nnc(CCOC(=O)CCSc2ccccc2)o1.
What is the InChIKey of 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate?
The InChIKey is XKJBOLORTFVMDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3S/c1-11-15-16-13(19-11)7-9-18-14(17)8-10-20-12-5-3-2-4-6-12/h2-6H,7-10H2,1H3.
What are the key properties of 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate?
2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate has a molecular weight of 292.36 g/mol, XLogP of 2.65, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 3-phenylsulfanylpropanoate is sourced from PubChem (CID 126834028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).