About N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide
N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide (PubChem CID 126834628) has the molecular formula C8H8Cl2N2OS
and a molecular weight of 251.14 g/mol. Its IUPAC name is N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide |
| PubChem CID | 126834628 |
| Molecular Formula | C8H8Cl2N2OS |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC=C(Cl)Cl)ns1 |
| InChI | InChI=1S/C8H8Cl2N2OS/c1-5-4-6(12-14-5)8(13)11-3-2-7(9)10/h2,4H,3H2,1H3,(H,11,13) |
| InChIKey | WRNLRXLFCOGMGU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide?
The IUPAC name of N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide (CID 126834628) is N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide.
What is the SMILES notation for N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide?
The canonical SMILES for N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide is Cc1cc(C(=O)NCC=C(Cl)Cl)ns1.
What is the InChIKey of N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide?
The InChIKey is WRNLRXLFCOGMGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N2OS/c1-5-4-6(12-14-5)8(13)11-3-2-7(9)10/h2,4H,3H2,1H3,(H,11,13).
What are the key properties of N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide?
N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide has a molecular weight of 251.14 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dichloroprop-2-enyl)-5-methyl-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 126834628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).