About 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine
2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine (PubChem CID 126834756) has the molecular formula C18H19N5O
and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine |
| PubChem CID | 126834756 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine |
| SMILES | Cc1nccc(N[C@@H]2CCO[C@H]2c2ccnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C18H19N5O/c1-13-19-10-8-17(21-13)22-15-9-12-24-18(15)16-7-11-20-23(16)14-5-3-2-4-6-14/h2-8,10-11,15,18H,9,12H2,1H3,(H,19,21,22)/t15-,18-/m1/s1 |
| InChIKey | GDZCZATWBCWKBH-CRAIPNDOSA-N |
| XLogP | 2.91 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine?
The IUPAC name of 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine (CID 126834756) is 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine.
What is the SMILES notation for 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine?
The canonical SMILES for 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine is Cc1nccc(N[C@@H]2CCO[C@H]2c2ccnn2-c2ccccc2)n1.
What is the InChIKey of 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine?
The InChIKey is GDZCZATWBCWKBH-CRAIPNDOSA-N. The full InChI is InChI=1S/C18H19N5O/c1-13-19-10-8-17(21-13)22-15-9-12-24-18(15)16-7-11-20-23(16)14-5-3-2-4-6-14/h2-8,10-11,15,18H,9,12H2,1H3,(H,19,21,22)/t15-,18-/m1/s1.
What are the key properties of 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine?
2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine has a molecular weight of 321.38 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(2R,3R)-2-(2-phenylpyrazol-3-yl)oxolan-3-yl]pyrimidin-4-amine is sourced from PubChem (CID 126834756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).