About dipropylcyanamide
dipropylcyanamide (PubChem CID 12683494) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is dipropylcyanamide.
Molecular Properties
| Compound Name | dipropylcyanamide |
| PubChem CID | 12683494 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | dipropylcyanamide |
| SMILES | CCCN(C#N)CCC |
| InChI | InChI=1S/C7H14N2/c1-3-5-9(7-8)6-4-2/h3-6H2,1-2H3 |
| InChIKey | JAMAIRVUEDZCTM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze dipropylcyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropylcyanamide?
The IUPAC name of dipropylcyanamide (CID 12683494) is dipropylcyanamide.
What is the SMILES notation for dipropylcyanamide?
The canonical SMILES for dipropylcyanamide is CCCN(C#N)CCC.
What is the InChIKey of dipropylcyanamide?
The InChIKey is JAMAIRVUEDZCTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-5-9(7-8)6-4-2/h3-6H2,1-2H3.
What are the key properties of dipropylcyanamide?
dipropylcyanamide has a molecular weight of 126.20 g/mol, XLogP of 1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipropylcyanamide is sourced from PubChem (CID 12683494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).