C11H21N3O3S2 — CID 126835128
[1-(thiomorpholine-4-carbonyl)piperidin-2-yl]methanesulfonamide (PubChem CID 126835128) has the molecular formula C11H21N3O3S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is [1-(thiomorpholine-4-carbonyl)piperidin-2-yl]methanesulfonamide.
| Compound Name | [1-(thiomorpholine-4-carbonyl)piperidin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 126835128 |
| Molecular Formula | C11H21N3O3S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | [1-(thiomorpholine-4-carbonyl)piperidin-2-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CCCCN1C(=O)N1CCSCC1 |
| InChI | InChI=1S/C11H21N3O3S2/c12-19(16,17)9-10-3-1-2-4-14(10)11(15)13-5-7-18-8-6-13/h10H,1-9H2,(H2,12,16,17) |
| InChIKey | YPSDWVAFBMIUIO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |