C16H22N4O3 — CID 126835286
3-(2-methoxyethoxy)-N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]benzamide (PubChem CID 126835286) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]benzamide.
| Compound Name | 3-(2-methoxyethoxy)-N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]benzamide |
|---|---|
| PubChem CID | 126835286 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-(2-methoxyethoxy)-N-[3-(1-methyl-1,2,4-triazol-3-yl)propyl]benzamide |
| SMILES | COCCOc1cccc(C(=O)NCCCc2ncn(C)n2)c1 |
| InChI | InChI=1S/C16H22N4O3/c1-20-12-18-15(19-20)7-4-8-17-16(21)13-5-3-6-14(11-13)23-10-9-22-2/h3,5-6,11-12H,4,7-10H2,1-2H3,(H,17,21) |
| InChIKey | QTIBZXUDIDPUEJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|