About 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one
4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one (PubChem CID 126835299) has the molecular formula C17H29NO4S
and a molecular weight of 343.49 g/mol. Its IUPAC name is 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one.
Molecular Properties
| Compound Name | 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one |
| PubChem CID | 126835299 |
| Molecular Formula | C17H29NO4S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one |
| SMILES | O=C(CCCC1CCCCC1)N1CCOC2(CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C17H29NO4S/c19-16(8-4-7-15-5-2-1-3-6-15)18-10-11-22-17(13-18)9-12-23(20,21)14-17/h15H,1-14H2 |
| InChIKey | NYWILTMOASOMBW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one?
The IUPAC name of 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one (CID 126835299) is 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one.
What is the SMILES notation for 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one?
The canonical SMILES for 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one is O=C(CCCC1CCCCC1)N1CCOC2(CCS(=O)(=O)C2)C1.
What is the InChIKey of 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one?
The InChIKey is NYWILTMOASOMBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO4S/c19-16(8-4-7-15-5-2-1-3-6-15)18-10-11-22-17(13-18)9-12-23(20,21)14-17/h15H,1-14H2.
What are the key properties of 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one?
4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one has a molecular weight of 343.49 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-1-(2,2-dioxo-6-oxa-2λ6-thia-9-azaspiro[4.5]decan-9-yl)butan-1-one is sourced from PubChem (CID 126835299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).