About tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate
tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate (PubChem CID 126835309) has the molecular formula C16H27N5O3
and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate |
| PubChem CID | 126835309 |
| Molecular Formula | C16H27N5O3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate |
| SMILES | CC1C(C)N(C(=O)c2cn(C)nn2)C(C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27N5O3/c1-10-8-20(15(23)24-16(4,5)6)11(2)12(3)21(10)14(22)13-9-19(7)18-17-13/h9-12H,8H2,1-7H3 |
| InChIKey | AVWTYTNDNBJTBZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate?
The IUPAC name of tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate (CID 126835309) is tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate is CC1C(C)N(C(=O)c2cn(C)nn2)C(C)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate?
The InChIKey is AVWTYTNDNBJTBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N5O3/c1-10-8-20(15(23)24-16(4,5)6)11(2)12(3)21(10)14(22)13-9-19(7)18-17-13/h9-12H,8H2,1-7H3.
What are the key properties of tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate?
tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate has a molecular weight of 337.42 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,3,5-trimethyl-4-(1-methyltriazole-4-carbonyl)piperazine-1-carboxylate is sourced from PubChem (CID 126835309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).