About 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine
4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine (PubChem CID 126835708) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine.
Molecular Properties
| Compound Name | 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine |
| PubChem CID | 126835708 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine |
| SMILES | CCC1CN(c2cc(C)nc(C)n2)C(CC)CO1 |
| InChI | InChI=1S/C14H23N3O/c1-5-12-9-18-13(6-2)8-17(12)14-7-10(3)15-11(4)16-14/h7,12-13H,5-6,8-9H2,1-4H3 |
| InChIKey | UHYJQRWKWORXLO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine?
The IUPAC name of 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine (CID 126835708) is 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine.
What is the SMILES notation for 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine?
The canonical SMILES for 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine is CCC1CN(c2cc(C)nc(C)n2)C(CC)CO1.
What is the InChIKey of 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine?
The InChIKey is UHYJQRWKWORXLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O/c1-5-12-9-18-13(6-2)8-17(12)14-7-10(3)15-11(4)16-14/h7,12-13H,5-6,8-9H2,1-4H3.
What are the key properties of 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine?
4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine has a molecular weight of 249.36 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dimethylpyrimidin-4-yl)-2,5-diethylmorpholine is sourced from PubChem (CID 126835708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).