C10H17N5O3S — CID 126835742
N-[[1-(1-methyl-2-oxopyrrolidin-3-yl)triazol-4-yl]methyl]ethanesulfonamide (PubChem CID 126835742) has the molecular formula C10H17N5O3S and a molecular weight of 287.35 g/mol. Its IUPAC name is N-[[1-(1-methyl-2-oxopyrrolidin-3-yl)triazol-4-yl]methyl]ethanesulfonamide.
| Compound Name | N-[[1-(1-methyl-2-oxopyrrolidin-3-yl)triazol-4-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 126835742 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[[1-(1-methyl-2-oxopyrrolidin-3-yl)triazol-4-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCc1cn(C2CCN(C)C2=O)nn1 |
| InChI | InChI=1S/C10H17N5O3S/c1-3-19(17,18)11-6-8-7-15(13-12-8)9-4-5-14(2)10(9)16/h7,9,11H,3-6H2,1-2H3 |
| InChIKey | WWSWELCAVKUCDJ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |