C23H30N4O2 — CID 126835808
1-[(1S,3R)-3-(piperidine-1-carbonyl)cyclopentyl]-3-(2-quinolin-4-ylethyl)urea (PubChem CID 126835808) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[(1S,3R)-3-(piperidine-1-carbonyl)cyclopentyl]-3-(2-quinolin-4-ylethyl)urea.
| Compound Name | 1-[(1S,3R)-3-(piperidine-1-carbonyl)cyclopentyl]-3-(2-quinolin-4-ylethyl)urea |
|---|---|
| PubChem CID | 126835808 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-[(1S,3R)-3-(piperidine-1-carbonyl)cyclopentyl]-3-(2-quinolin-4-ylethyl)urea |
| SMILES | O=C(NCCc1ccnc2ccccc12)N[C@H]1CC[C@@H](C(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C23H30N4O2/c28-22(27-14-4-1-5-15-27)18-8-9-19(16-18)26-23(29)25-13-11-17-10-12-24-21-7-3-2-6-20(17)21/h2-3,6-7,10,12,18-19H,1,4-5,8-9,11,13-16H2,(H2,25,26,29)/t18-,19+/m1/s1 |
| InChIKey | ZOYKNCKKBMABCD-MOPGFXCFSA-N |
| XLogP | 3.26 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |