About methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride
methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride (PubChem CID 126836128) has the molecular formula C8H16ClNO3
and a molecular weight of 209.67 g/mol. Its IUPAC name is methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride |
| PubChem CID | 126836128 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)C1(C)CC(O)CN1C.Cl |
| InChI | InChI=1S/C8H15NO3.ClH/c1-8(7(11)12-3)4-6(10)5-9(8)2;/h6,10H,4-5H2,1-3H3;1H |
| InChIKey | BTPUNAJXJGDLDY-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride?
The IUPAC name of methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride (CID 126836128) is methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride is COC(=O)C1(C)CC(O)CN1C.Cl.
What is the InChIKey of methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride?
The InChIKey is BTPUNAJXJGDLDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3.ClH/c1-8(7(11)12-3)4-6(10)5-9(8)2;/h6,10H,4-5H2,1-3H3;1H.
What are the key properties of methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride?
methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride has a molecular weight of 209.67 g/mol, XLogP of 0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxy-1,2-dimethylpyrrolidine-2-carboxylate;hydrochloride is sourced from PubChem (CID 126836128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).