C16H21NO4S — CID 126837080
methyl 1-[[3-[(1-oxothiolan-1-ylidene)amino]phenoxy]methyl]cyclopropane-1-carboxylate (PubChem CID 126837080) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is methyl 1-[[3-[(1-oxothiolan-1-ylidene)amino]phenoxy]methyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[[3-[(1-oxothiolan-1-ylidene)amino]phenoxy]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 126837080 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl 1-[[3-[(1-oxothiolan-1-ylidene)amino]phenoxy]methyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(COc2cccc(N=S3(=O)CCCC3)c2)CC1 |
| InChI | InChI=1S/C16H21NO4S/c1-20-15(18)16(7-8-16)12-21-14-6-4-5-13(11-14)17-22(19)9-2-3-10-22/h4-6,11H,2-3,7-10,12H2,1H3 |
| InChIKey | AGXJNTAGFQWPMQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |