C12H13N3O4 — CID 126837317
methyl 5-[[4-(methylamino)-6-oxopyridazin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126837317) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is methyl 5-[[4-(methylamino)-6-oxopyridazin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-(methylamino)-6-oxopyridazin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126837317 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | methyl 5-[[4-(methylamino)-6-oxopyridazin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CNc1cnn(Cc2ccc(C(=O)OC)o2)c(=O)c1 |
| InChI | InChI=1S/C12H13N3O4/c1-13-8-5-11(16)15(14-6-8)7-9-3-4-10(19-9)12(17)18-2/h3-6,13H,7H2,1-2H3 |
| InChIKey | PPTDFGUIDMDIGE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |