C11H18N2O2 — CID 126837976
N-[(3-methoxy-1,2-oxazol-5-yl)methyl]cyclohexanamine (PubChem CID 126837976) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-[(3-methoxy-1,2-oxazol-5-yl)methyl]cyclohexanamine.
| Compound Name | N-[(3-methoxy-1,2-oxazol-5-yl)methyl]cyclohexanamine |
|---|---|
| PubChem CID | 126837976 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-[(3-methoxy-1,2-oxazol-5-yl)methyl]cyclohexanamine |
| SMILES | COc1cc(CNC2CCCCC2)on1 |
| InChI | InChI=1S/C11H18N2O2/c1-14-11-7-10(15-13-11)8-12-9-5-3-2-4-6-9/h7,9,12H,2-6,8H2,1H3 |
| InChIKey | JHZKBELLPKYFFR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |