About 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile
6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile (PubChem CID 126838530) has the molecular formula C21H23N5
and a molecular weight of 345.45 g/mol. Its IUPAC name is 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile |
| PubChem CID | 126838530 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile |
| SMILES | N#Cc1cncc(N2CC3CCC2C2CN(Cc4ccccc4)CC32)n1 |
| InChI | InChI=1S/C21H23N5/c22-8-17-9-23-10-21(24-17)26-12-16-6-7-20(26)19-14-25(13-18(16)19)11-15-4-2-1-3-5-15/h1-5,9-10,16,18-20H,6-7,11-14H2 |
| InChIKey | GURSEAFPJAVQIY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile?
The IUPAC name of 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile (CID 126838530) is 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile.
What is the SMILES notation for 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile?
The canonical SMILES for 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile is N#Cc1cncc(N2CC3CCC2C2CN(Cc4ccccc4)CC32)n1.
What is the InChIKey of 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile?
The InChIKey is GURSEAFPJAVQIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N5/c22-8-17-9-23-10-21(24-17)26-12-16-6-7-20(26)19-14-25(13-18(16)19)11-15-4-2-1-3-5-15/h1-5,9-10,16,18-20H,6-7,11-14H2.
What are the key properties of 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile?
6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile has a molecular weight of 345.45 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-benzyl-4,8-diazatricyclo[5.2.2.02,6]undecan-8-yl)pyrazine-2-carbonitrile is sourced from PubChem (CID 126838530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).