About methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate
methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate (PubChem CID 126839601) has the molecular formula C11H12N2O5S2
and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate |
| PubChem CID | 126839601 |
| Molecular Formula | C11H12N2O5S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2cc(C)sc2C)on1 |
| InChI | InChI=1S/C11H12N2O5S2/c1-6-4-9(7(2)19-6)20(15,16)13-10-5-8(12-18-10)11(14)17-3/h4-5,13H,1-3H3 |
| InChIKey | WGSNXGMRAVJVNV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate?
The IUPAC name of methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate (CID 126839601) is methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate.
What is the SMILES notation for methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate?
The canonical SMILES for methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate is COC(=O)c1cc(NS(=O)(=O)c2cc(C)sc2C)on1.
What is the InChIKey of methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate?
The InChIKey is WGSNXGMRAVJVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O5S2/c1-6-4-9(7(2)19-6)20(15,16)13-10-5-8(12-18-10)11(14)17-3/h4-5,13H,1-3H3.
What are the key properties of methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate?
methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate has a molecular weight of 316.36 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 126839601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).