About N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide
N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide (PubChem CID 126840047) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide.
Molecular Properties
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide |
| PubChem CID | 126840047 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide |
| SMILES | CC(C)=C(C)CC(=O)NCc1cnn(C)c1C |
| InChI | InChI=1S/C13H21N3O/c1-9(2)10(3)6-13(17)14-7-12-8-15-16(5)11(12)4/h8H,6-7H2,1-5H3,(H,14,17) |
| InChIKey | ZWOAPSMSADOLER-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide?
The IUPAC name of N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide (CID 126840047) is N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide.
What is the SMILES notation for N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide?
The canonical SMILES for N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide is CC(C)=C(C)CC(=O)NCc1cnn(C)c1C.
What is the InChIKey of N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide?
The InChIKey is ZWOAPSMSADOLER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O/c1-9(2)10(3)6-13(17)14-7-12-8-15-16(5)11(12)4/h8H,6-7H2,1-5H3,(H,14,17).
What are the key properties of N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide?
N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide has a molecular weight of 235.33 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,5-dimethylpyrazol-4-yl)methyl]-3,4-dimethylpent-3-enamide is sourced from PubChem (CID 126840047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).