C12H14N6O2 — CID 126840196
N-[(1-cyclobutyltriazol-4-yl)methyl]-3-nitropyridin-2-amine (PubChem CID 126840196) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-[(1-cyclobutyltriazol-4-yl)methyl]-3-nitropyridin-2-amine.
| Compound Name | N-[(1-cyclobutyltriazol-4-yl)methyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126840196 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-[(1-cyclobutyltriazol-4-yl)methyl]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1NCc1cn(C2CCC2)nn1 |
| InChI | InChI=1S/C12H14N6O2/c19-18(20)11-5-2-6-13-12(11)14-7-9-8-17(16-15-9)10-3-1-4-10/h2,5-6,8,10H,1,3-4,7H2,(H,13,14) |
| InChIKey | REQQMVYSNBCQBR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|