About tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate
tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 126840248) has the molecular formula C18H19N3O3
and a molecular weight of 325.37 g/mol. Its IUPAC name is tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate.
Molecular Properties
| Compound Name | tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate |
| PubChem CID | 126840248 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)c1nc(-c2nccc3ccccc23)no1 |
| InChI | InChI=1S/C18H19N3O3/c1-11(17(22)23-18(2,3)4)16-20-15(21-24-16)14-13-8-6-5-7-12(13)9-10-19-14/h5-11H,1-4H3 |
| InChIKey | ZPTMQJLDDMKQQI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate?
The IUPAC name of tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate (CID 126840248) is tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate.
What is the SMILES notation for tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate?
The canonical SMILES for tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate is CC(C(=O)OC(C)(C)C)c1nc(-c2nccc3ccccc23)no1.
What is the InChIKey of tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate?
The InChIKey is ZPTMQJLDDMKQQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O3/c1-11(17(22)23-18(2,3)4)16-20-15(21-24-16)14-13-8-6-5-7-12(13)9-10-19-14/h5-11H,1-4H3.
What are the key properties of tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate?
tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate has a molecular weight of 325.37 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)propanoate is sourced from PubChem (CID 126840248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).