C16H19FN6O — CID 126840330
4-[3-[[4-(3-fluorophenyl)-1,3,5-triazin-2-yl]amino]propyl]piperazin-2-one (PubChem CID 126840330) has the molecular formula C16H19FN6O and a molecular weight of 330.37 g/mol. Its IUPAC name is 4-[3-[[4-(3-fluorophenyl)-1,3,5-triazin-2-yl]amino]propyl]piperazin-2-one.
| Compound Name | 4-[3-[[4-(3-fluorophenyl)-1,3,5-triazin-2-yl]amino]propyl]piperazin-2-one |
|---|---|
| PubChem CID | 126840330 |
| Molecular Formula | C16H19FN6O |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[3-[[4-(3-fluorophenyl)-1,3,5-triazin-2-yl]amino]propyl]piperazin-2-one |
| SMILES | O=C1CN(CCCNc2ncnc(-c3cccc(F)c3)n2)CCN1 |
| InChI | InChI=1S/C16H19FN6O/c17-13-4-1-3-12(9-13)15-20-11-21-16(22-15)19-5-2-7-23-8-6-18-14(24)10-23/h1,3-4,9,11H,2,5-8,10H2,(H,18,24)(H,19,20,21,22) |
| InChIKey | DVFQWBDHVVVLEL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|