C16H22N2O4 — CID 126840637
(2S,3R,4R)-4-hydroxy-N-(4-hydroxybutyl)-1-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide (PubChem CID 126840637) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2S,3R,4R)-4-hydroxy-N-(4-hydroxybutyl)-1-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide.
| Compound Name | (2S,3R,4R)-4-hydroxy-N-(4-hydroxybutyl)-1-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126840637 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2S,3R,4R)-4-hydroxy-N-(4-hydroxybutyl)-1-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide |
| SMILES | CN1C(=O)[C@H](O)[C@H](C(=O)NCCCCO)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H22N2O4/c1-18-13(11-7-3-2-4-8-11)12(14(20)16(18)22)15(21)17-9-5-6-10-19/h2-4,7-8,12-14,19-20H,5-6,9-10H2,1H3,(H,17,21)/t12-,13-,14-/m1/s1 |
| InChIKey | JRRGIRACLOVDBB-MGPQQGTHSA-N |
| XLogP | 0.07 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|