About [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone
[1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone (PubChem CID 126840779) has the molecular formula C13H20F3NO3S
and a molecular weight of 327.37 g/mol. Its IUPAC name is [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone.
Molecular Properties
| Compound Name | [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone |
| PubChem CID | 126840779 |
| Molecular Formula | C13H20F3NO3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)C2CS(=O)(=O)CC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H20F3NO3S/c1-9-3-2-5-17(6-4-9)12(18)10-7-21(19,20)8-11(10)13(14,15)16/h9-11H,2-8H2,1H3 |
| InChIKey | BBKGWYIEWIJPKA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone?
The IUPAC name of [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone (CID 126840779) is [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone.
What is the SMILES notation for [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone?
The canonical SMILES for [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone is CC1CCCN(C(=O)C2CS(=O)(=O)CC2C(F)(F)F)CC1.
What is the InChIKey of [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone?
The InChIKey is BBKGWYIEWIJPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3NO3S/c1-9-3-2-5-17(6-4-9)12(18)10-7-21(19,20)8-11(10)13(14,15)16/h9-11H,2-8H2,1H3.
What are the key properties of [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone?
[1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone has a molecular weight of 327.37 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-dioxo-4-(trifluoromethyl)thiolan-3-yl]-(4-methylazepan-1-yl)methanone is sourced from PubChem (CID 126840779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).