C18H22N4O3 — CID 126841057
2-(hydroxymethyl)-N-[[4-(pyridin-4-ylamino)phenyl]methyl]morpholine-4-carboxamide (PubChem CID 126841057) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N-[[4-(pyridin-4-ylamino)phenyl]methyl]morpholine-4-carboxamide.
| Compound Name | 2-(hydroxymethyl)-N-[[4-(pyridin-4-ylamino)phenyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 126841057 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-(hydroxymethyl)-N-[[4-(pyridin-4-ylamino)phenyl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NCc1ccc(Nc2ccncc2)cc1)N1CCOC(CO)C1 |
| InChI | InChI=1S/C18H22N4O3/c23-13-17-12-22(9-10-25-17)18(24)20-11-14-1-3-15(4-2-14)21-16-5-7-19-8-6-16/h1-8,17,23H,9-13H2,(H,19,21)(H,20,24) |
| InChIKey | SGDMGMGNZVXKGN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |