C12H17N3O2 — CID 126841376
1-[2-(1-ethylpyrazol-4-yl)morpholin-4-yl]prop-2-en-1-one (PubChem CID 126841376) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-[2-(1-ethylpyrazol-4-yl)morpholin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[2-(1-ethylpyrazol-4-yl)morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 126841376 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-[2-(1-ethylpyrazol-4-yl)morpholin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCOC(c2cnn(CC)c2)C1 |
| InChI | InChI=1S/C12H17N3O2/c1-3-12(16)14-5-6-17-11(9-14)10-7-13-15(4-2)8-10/h3,7-8,11H,1,4-6,9H2,2H3 |
| InChIKey | RKHNBGJRHSJJJM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|