C37H47N3O6S2 — CID 126842509
[4-[9-[[(2R)-2-(2,8-dioxoquinolin-5-yl)-2-hydroxyethyl]amino]nonyl-methylamino]cyclohexyl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 126842509) has the molecular formula C37H47N3O6S2 and a molecular weight of 693.93 g/mol. Its IUPAC name is [4-[9-[[(2R)-2-(2,8-dioxoquinolin-5-yl)-2-hydroxyethyl]amino]nonyl-methylamino]cyclohexyl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [4-[9-[[(2R)-2-(2,8-dioxoquinolin-5-yl)-2-hydroxyethyl]amino]nonyl-methylamino]cyclohexyl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 126842509 |
| Molecular Formula | C37H47N3O6S2 |
| Molecular Weight | 693.93 g/mol |
| Exact Mass | 693.29 |
| IUPAC Name | [4-[9-[[(2R)-2-(2,8-dioxoquinolin-5-yl)-2-hydroxyethyl]amino]nonyl-methylamino]cyclohexyl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | CN(CCCCCCCCCNC[C@H](O)C1=C2C=CC(=O)N=C2C(=O)C=C1)C1CCC(OC(=O)C(O)(c2cccs2)c2cccs2)CC1 |
| InChI | InChI=1S/C37H47N3O6S2/c1-40(26-13-15-27(16-14-26)46-36(44)37(45,32-11-9-23-47-32)33-12-10-24-48-33)22-8-6-4-2-3-5-7-21-38-25-31(42)28-17-19-30(41)35-29(28)18-20-34(43)39-35/h9-12,17-20,23-24,26-27,31,38,42,45H,2-8,13-16,21-22,25H2,1H3/t26?,27?,31-/m0/s1 |
| InChIKey | TUMNTDLFPXQXML-OXVIYWBMSA-N |
| XLogP | 5.49 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.93 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'} |
|---|