C22H17NO4 — CID 126842613
(1S,2R,6S,7R)-4-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126842613) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126842613 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (1S,2R,6S,7R)-4-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C(/C=C/c1ccco1)c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@H]3C2)cc1 |
| InChI | InChI=1S/C22H17NO4/c24-18(10-9-17-2-1-11-27-17)13-5-7-16(8-6-13)23-21(25)19-14-3-4-15(12-14)20(19)22(23)26/h1-11,14-15,19-20H,12H2/b10-9+/t14-,15+,19-,20+ |
| InChIKey | CDKJSYMMXXELTE-XMLDZNDQSA-N |
| XLogP | 3.49 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|