C19H18N2O2S — CID 126842699
N,N-dimethyl-2,2-dioxo-4-phenyl-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine (PubChem CID 126842699) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is N,N-dimethyl-2,2-dioxo-4-phenyl-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine.
| Compound Name | N,N-dimethyl-2,2-dioxo-4-phenyl-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
|---|---|
| PubChem CID | 126842699 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N,N-dimethyl-2,2-dioxo-4-phenyl-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
| SMILES | CN(C)c1ccc2c3c(cccc13)S(=O)(=O)NC2c1ccccc1 |
| InChI | InChI=1S/C19H18N2O2S/c1-21(2)16-12-11-15-18-14(16)9-6-10-17(18)24(22,23)20-19(15)13-7-4-3-5-8-13/h3-12,19-20H,1-2H3 |
| InChIKey | KJDSZALOAPOBHT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |