C20H20N2O2S2 — CID 126842703
N,N-dimethyl-4-(4-methylsulfanylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine (PubChem CID 126842703) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-methylsulfanylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine.
| Compound Name | N,N-dimethyl-4-(4-methylsulfanylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
|---|---|
| PubChem CID | 126842703 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N,N-dimethyl-4-(4-methylsulfanylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
| SMILES | CSc1ccc(C2NS(=O)(=O)c3cccc4c(N(C)C)ccc2c34)cc1 |
| InChI | InChI=1S/C20H20N2O2S2/c1-22(2)17-12-11-16-19-15(17)5-4-6-18(19)26(23,24)21-20(16)13-7-9-14(25-3)10-8-13/h4-12,20-21H,1-3H3 |
| InChIKey | AUDPOGBMPJNTBX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |