C19H17N3O4S — CID 126842704
N,N-dimethyl-4-(3-nitrophenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine (PubChem CID 126842704) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-nitrophenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine.
| Compound Name | N,N-dimethyl-4-(3-nitrophenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
|---|---|
| PubChem CID | 126842704 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N,N-dimethyl-4-(3-nitrophenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
| SMILES | CN(C)c1ccc2c3c(cccc13)S(=O)(=O)NC2c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N3O4S/c1-21(2)16-10-9-15-18-14(16)7-4-8-17(18)27(25,26)20-19(15)12-5-3-6-13(11-12)22(23)24/h3-11,19-20H,1-2H3 |
| InChIKey | DMUMVDROXAUWIO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|