C20H20N2O3S — CID 126842707
4-(2-methoxyphenyl)-N,N-dimethyl-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine (PubChem CID 126842707) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N,N-dimethyl-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine.
| Compound Name | 4-(2-methoxyphenyl)-N,N-dimethyl-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
|---|---|
| PubChem CID | 126842707 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-(2-methoxyphenyl)-N,N-dimethyl-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
| SMILES | COc1ccccc1C1NS(=O)(=O)c2cccc3c(N(C)C)ccc1c23 |
| InChI | InChI=1S/C20H20N2O3S/c1-22(2)16-12-11-15-19-13(16)8-6-10-18(19)26(23,24)21-20(15)14-7-4-5-9-17(14)25-3/h4-12,20-21H,1-3H3 |
| InChIKey | XCFDDEOGVFLXBA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |