C20H20N2O4S — CID 126842709
5-[8-(dimethylamino)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-4-yl]-2-methoxyphenol (PubChem CID 126842709) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 5-[8-(dimethylamino)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-4-yl]-2-methoxyphenol.
| Compound Name | 5-[8-(dimethylamino)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-4-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 126842709 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 5-[8-(dimethylamino)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-4-yl]-2-methoxyphenol |
| SMILES | COc1ccc(C2NS(=O)(=O)c3cccc4c(N(C)C)ccc2c34)cc1O |
| InChI | InChI=1S/C20H20N2O4S/c1-22(2)15-9-8-14-19-13(15)5-4-6-18(19)27(24,25)21-20(14)12-7-10-17(26-3)16(23)11-12/h4-11,20-21,23H,1-3H3 |
| InChIKey | NGSBQVKCJPOFSC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |