C20H19BrN2O3S — CID 126842710
4-(3-bromo-4-methoxyphenyl)-N,N-dimethyl-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine (PubChem CID 126842710) has the molecular formula C20H19BrN2O3S and a molecular weight of 447.35 g/mol. Its IUPAC name is 4-(3-bromo-4-methoxyphenyl)-N,N-dimethyl-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine.
| Compound Name | 4-(3-bromo-4-methoxyphenyl)-N,N-dimethyl-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
|---|---|
| PubChem CID | 126842710 |
| Molecular Formula | C20H19BrN2O3S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 4-(3-bromo-4-methoxyphenyl)-N,N-dimethyl-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
| SMILES | COc1ccc(C2NS(=O)(=O)c3cccc4c(N(C)C)ccc2c34)cc1Br |
| InChI | InChI=1S/C20H19BrN2O3S/c1-23(2)16-9-8-14-19-13(16)5-4-6-18(19)27(24,25)22-20(14)12-7-10-17(26-3)15(21)11-12/h4-11,20,22H,1-3H3 |
| InChIKey | ADPYHOYMLSCAFL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |