About 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine
6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine (PubChem CID 126842786) has the molecular formula C16H16N6O2
and a molecular weight of 324.34 g/mol. Its IUPAC name is 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine |
| PubChem CID | 126842786 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine |
| SMILES | Cc1ccc(Nc2ccc(-n3nc(C)c([N+](=O)[O-])c3C)nn2)cc1 |
| InChI | InChI=1S/C16H16N6O2/c1-10-4-6-13(7-5-10)17-14-8-9-15(19-18-14)21-12(3)16(22(23)24)11(2)20-21/h4-9H,1-3H3,(H,17,18) |
| InChIKey | QGGSPFQHKDHNHI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine?
The IUPAC name of 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine (CID 126842786) is 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine.
What is the SMILES notation for 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine?
The canonical SMILES for 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine is Cc1ccc(Nc2ccc(-n3nc(C)c([N+](=O)[O-])c3C)nn2)cc1.
What is the InChIKey of 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine?
The InChIKey is QGGSPFQHKDHNHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6O2/c1-10-4-6-13(7-5-10)17-14-8-9-15(19-18-14)21-12(3)16(22(23)24)11(2)20-21/h4-9H,1-3H3,(H,17,18).
What are the key properties of 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine?
6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine has a molecular weight of 324.34 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylphenyl)pyridazin-3-amine is sourced from PubChem (CID 126842786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).