C24H30N2O3 — CID 126842844
2-(piperidin-1-ylmethyl)-5-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol (PubChem CID 126842844) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-(piperidin-1-ylmethyl)-5-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol.
| Compound Name | 2-(piperidin-1-ylmethyl)-5-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 126842844 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-(piperidin-1-ylmethyl)-5-[(E)-2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethenyl]phenol |
| SMILES | Cc1ncc(/C=C/c2ccc(CN3CCCCC3)c(O)c2)c2c1OC(C)(C)OC2 |
| InChI | InChI=1S/C24H30N2O3/c1-17-23-21(16-28-24(2,3)29-23)19(14-25-17)9-7-18-8-10-20(22(27)13-18)15-26-11-5-4-6-12-26/h7-10,13-14,27H,4-6,11-12,15-16H2,1-3H3/b9-7+ |
| InChIKey | KEMRSZTUJBXUKD-VQHVLOKHSA-N |
| XLogP | 4.90 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|