C24H16BrClFNO3 — CID 126842857
(4E)-1-(3-bromo-4-methylphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 126842857) has the molecular formula C24H16BrClFNO3 and a molecular weight of 500.75 g/mol. Its IUPAC name is (4E)-1-(3-bromo-4-methylphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-bromo-4-methylphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 126842857 |
| Molecular Formula | C24H16BrClFNO3 |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | (4E)-1-(3-bromo-4-methylphenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(Cl)cc3)C2c2ccccc2F)cc1Br |
| InChI | InChI=1S/C24H16BrClFNO3/c1-13-6-11-16(12-18(13)25)28-21(17-4-2-3-5-19(17)27)20(23(30)24(28)31)22(29)14-7-9-15(26)10-8-14/h2-12,21,29H,1H3/b22-20+ |
| InChIKey | JQMZETDXOWFUPV-LSDHQDQOSA-N |
| XLogP | 6.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|