C25H17Cl3FNO3 — CID 126842880
(4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[2-(2,4-dichlorophenyl)ethyl]-5-(3-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 126842880) has the molecular formula C25H17Cl3FNO3 and a molecular weight of 504.77 g/mol. Its IUPAC name is (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[2-(2,4-dichlorophenyl)ethyl]-5-(3-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[2-(2,4-dichlorophenyl)ethyl]-5-(3-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 126842880 |
| Molecular Formula | C25H17Cl3FNO3 |
| Molecular Weight | 504.77 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[2-(2,4-dichlorophenyl)ethyl]-5-(3-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCc2ccc(Cl)cc2Cl)C(c2cccc(F)c2)/C1=C(\O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H17Cl3FNO3/c26-17-7-5-15(6-8-17)23(31)21-22(16-2-1-3-19(29)12-16)30(25(33)24(21)32)11-10-14-4-9-18(27)13-20(14)28/h1-9,12-13,22,31H,10-11H2/b23-21+ |
| InChIKey | NBVJYZLTJNNUJI-XTQSDGFTSA-N |
| XLogP | 6.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|