C22H33N7O — CID 126842945
7-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[(1-methylindol-4-yl)amino]-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[3,4-d]pyridazin-4-one (PubChem CID 126842945) has the molecular formula C22H33N7O and a molecular weight of 411.55 g/mol. Its IUPAC name is 7-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[(1-methylindol-4-yl)amino]-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[3,4-d]pyridazin-4-one.
| Compound Name | 7-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[(1-methylindol-4-yl)amino]-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 126842945 |
| Molecular Formula | C22H33N7O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 7-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[(1-methylindol-4-yl)amino]-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[3,4-d]pyridazin-4-one |
| SMILES | Cn1ccc2c(NC3NC(N[C@@H]4CCCC[C@@H]4N)CC4CNNC(=O)C43)cccc21 |
| InChI | InChI=1S/C22H33N7O/c1-29-10-9-14-16(7-4-8-18(14)29)26-21-20-13(12-24-28-22(20)30)11-19(27-21)25-17-6-3-2-5-15(17)23/h4,7-10,13,15,17,19-21,24-27H,2-3,5-6,11-12,23H2,1H3,(H,28,30)/t13?,15-,17+,19?,20?,21?/m0/s1 |
| InChIKey | MONMWZYBWFWLRK-UKTMXOIXSA-N |
| XLogP | 0.96 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |