About 6-methylpyrrolo[2,3-d]pyrimidin-4-one
6-methylpyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 126843022) has the molecular formula C7H5N3O
and a molecular weight of 147.14 g/mol. Its IUPAC name is 6-methylpyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-methylpyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 126843022 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 6-methylpyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CC1=NC2=NC=NC(=O)C2=C1 |
| InChI | InChI=1S/C7H5N3O/c1-4-2-5-6(10-4)8-3-9-7(5)11/h2-3H,1H3 |
| InChIKey | IJOYGTNHRUXVMA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methylpyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 6-methylpyrrolo[2,3-d]pyrimidin-4-one (CID 126843022) is 6-methylpyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 6-methylpyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 6-methylpyrrolo[2,3-d]pyrimidin-4-one is CC1=NC2=NC=NC(=O)C2=C1.
What is the InChIKey of 6-methylpyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is IJOYGTNHRUXVMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O/c1-4-2-5-6(10-4)8-3-9-7(5)11/h2-3H,1H3.
What are the key properties of 6-methylpyrrolo[2,3-d]pyrimidin-4-one?
6-methylpyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 147.14 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 126843022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).